C7H10N2OS2 — CID 82422332
2-(2-methoxyethyl)-1,3-thiazole-5-carbothioamide (PubChem CID 82422332) has the molecular formula C7H10N2OS2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 2-(2-methoxyethyl)-1,3-thiazole-5-carbothioamide.
| Compound Name | 2-(2-methoxyethyl)-1,3-thiazole-5-carbothioamide |
|---|---|
| PubChem CID | 82422332 |
| Molecular Formula | C7H10N2OS2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.02 |
| IUPAC Name | 2-(2-methoxyethyl)-1,3-thiazole-5-carbothioamide |
| SMILES | COCCc1ncc(C(N)=S)s1 |
| InChI | InChI=1S/C7H10N2OS2/c1-10-3-2-6-9-4-5(12-6)7(8)11/h4H,2-3H2,1H3,(H2,8,11) |
| InChIKey | ZBWYGYVABSTHRJ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|