C10H15NO5S — CID 126503353
2-methoxyethyl 2-(2-methoxyethoxy)-1,3-thiazole-5-carboxylate (PubChem CID 126503353) has the molecular formula C10H15NO5S and a molecular weight of 261.30 g/mol. Its IUPAC name is 2-methoxyethyl 2-(2-methoxyethoxy)-1,3-thiazole-5-carboxylate.
| Compound Name | 2-methoxyethyl 2-(2-methoxyethoxy)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 126503353 |
| Molecular Formula | C10H15NO5S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 2-methoxyethyl 2-(2-methoxyethoxy)-1,3-thiazole-5-carboxylate |
| SMILES | COCCOC(=O)c1cnc(OCCOC)s1 |
| InChI | InChI=1S/C10H15NO5S/c1-13-3-5-15-9(12)8-7-11-10(17-8)16-6-4-14-2/h7H,3-6H2,1-2H3 |
| InChIKey | MMBTVQBGWOZPJP-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|