C9H16N2O3S — CID 103400965
2-[3-(2-methoxyethoxy)propoxy]-1,3-thiazol-5-amine (PubChem CID 103400965) has the molecular formula C9H16N2O3S and a molecular weight of 232.30 g/mol. Its IUPAC name is 2-[3-(2-methoxyethoxy)propoxy]-1,3-thiazol-5-amine.
| Compound Name | 2-[3-(2-methoxyethoxy)propoxy]-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 103400965 |
| Molecular Formula | C9H16N2O3S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 2-[3-(2-methoxyethoxy)propoxy]-1,3-thiazol-5-amine |
| SMILES | COCCOCCCOc1ncc(N)s1 |
| InChI | InChI=1S/C9H16N2O3S/c1-12-5-6-13-3-2-4-14-9-11-7-8(10)15-9/h7H,2-6,10H2,1H3 |
| InChIKey | VKZANNCCMCSKJM-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|