C18H17NO5S — CID 167758388
2-(4-methoxynaphthalen-1-yl)oxyethyl 2-methoxy-1,3-thiazole-5-carboxylate (PubChem CID 167758388) has the molecular formula C18H17NO5S and a molecular weight of 359.40 g/mol. Its IUPAC name is 2-(4-methoxynaphthalen-1-yl)oxyethyl 2-methoxy-1,3-thiazole-5-carboxylate.
| Compound Name | 2-(4-methoxynaphthalen-1-yl)oxyethyl 2-methoxy-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 167758388 |
| Molecular Formula | C18H17NO5S |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 2-(4-methoxynaphthalen-1-yl)oxyethyl 2-methoxy-1,3-thiazole-5-carboxylate |
| SMILES | COc1ncc(C(=O)OCCOc2ccc(OC)c3ccccc23)s1 |
| InChI | InChI=1S/C18H17NO5S/c1-21-14-7-8-15(13-6-4-3-5-12(13)14)23-9-10-24-17(20)16-11-19-18(22-2)25-16/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | JMLGLPCYRSCONO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|