C8H13N3O2S — CID 165451079
2-(2-aminoethyl)-N-methoxy-N-methyl-1,3-thiazole-5-carboxamide (PubChem CID 165451079) has the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. Its IUPAC name is 2-(2-aminoethyl)-N-methoxy-N-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(2-aminoethyl)-N-methoxy-N-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 165451079 |
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 2-(2-aminoethyl)-N-methoxy-N-methyl-1,3-thiazole-5-carboxamide |
| SMILES | CON(C)C(=O)c1cnc(CCN)s1 |
| InChI | InChI=1S/C8H13N3O2S/c1-11(13-2)8(12)6-5-10-7(14-6)3-4-9/h5H,3-4,9H2,1-2H3 |
| InChIKey | ZMSAJQZMXNGAFG-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|