C6H7NO2S — CID 45117618
1,3-thiazol-4-ylmethyl acetate (PubChem CID 45117618) has the molecular formula C6H7NO2S and a molecular weight of 157.19 g/mol. Its IUPAC name is 1,3-thiazol-4-ylmethyl acetate.
| Compound Name | 1,3-thiazol-4-ylmethyl acetate |
|---|---|
| PubChem CID | 45117618 |
| Molecular Formula | C6H7NO2S |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.02 |
| IUPAC Name | 1,3-thiazol-4-ylmethyl acetate |
| SMILES | CC(=O)OCc1cscn1 |
| InChI | InChI=1S/C6H7NO2S/c1-5(8)9-2-6-3-10-4-7-6/h3-4H,2H2,1H3 |
| InChIKey | ASWPJTBZLYTDDD-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |