About 2-amino-3,3-dimethyl-2-(1,3-thiazol-4-ylmethyl)butanoic acid
2-amino-3,3-dimethyl-2-(1,3-thiazol-4-ylmethyl)butanoic acid (PubChem CID 68831374) has the molecular formula C10H16N2O2S
and a molecular weight of 228.32 g/mol. Its IUPAC name is 2-amino-3,3-dimethyl-2-(1,3-thiazol-4-ylmethyl)butanoic acid.
Analyze 2-amino-3,3-dimethyl-2-(1,3-thiazol-4-ylmethyl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3,3-dimethyl-2-(1,3-thiazol-4-ylmethyl)butanoic acid?
The IUPAC name of 2-amino-3,3-dimethyl-2-(1,3-thiazol-4-ylmethyl)butanoic acid (CID 68831374) is 2-amino-3,3-dimethyl-2-(1,3-thiazol-4-ylmethyl)butanoic acid.
What is the SMILES notation for 2-amino-3,3-dimethyl-2-(1,3-thiazol-4-ylmethyl)butanoic acid?
The canonical SMILES for 2-amino-3,3-dimethyl-2-(1,3-thiazol-4-ylmethyl)butanoic acid is CC(C)(C)C(N)(Cc1cscn1)C(=O)O.
What is the InChIKey of 2-amino-3,3-dimethyl-2-(1,3-thiazol-4-ylmethyl)butanoic acid?
The InChIKey is SVESIFYHLKNZSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2S/c1-9(2,3)10(11,8(13)14)4-7-5-15-6-12-7/h5-6H,4,11H2,1-3H3,(H,13,14).
What are the key properties of 2-amino-3,3-dimethyl-2-(1,3-thiazol-4-ylmethyl)butanoic acid?
2-amino-3,3-dimethyl-2-(1,3-thiazol-4-ylmethyl)butanoic acid has a molecular weight of 228.32 g/mol, XLogP of 1.51, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3,3-dimethyl-2-(1,3-thiazol-4-ylmethyl)butanoic acid is sourced from PubChem (CID 68831374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).