C25H32N6O4S3 — CID 144641135
[N'-[2-(3-methoxyphenyl)acetyl]carbamimidoyl] 3-[2-amino-2-[N-[2-(3-methoxyphenyl)acetyl]carbamimidoyl]sulfanylethyl]sulfanylpropanimidothioate (PubChem CID 144641135) has the molecular formula C25H32N6O4S3 and a molecular weight of 576.77 g/mol. Its IUPAC name is [N'-[2-(3-methoxyphenyl)acetyl]carbamimidoyl] 3-[2-amino-2-[N-[2-(3-methoxyphenyl)acetyl]carbamimidoyl]sulfanylethyl]sulfanylpropanimidothioate.
| Compound Name | [N'-[2-(3-methoxyphenyl)acetyl]carbamimidoyl] 3-[2-amino-2-[N-[2-(3-methoxyphenyl)acetyl]carbamimidoyl]sulfanylethyl]sulfanylpropanimidothioate |
|---|---|
| PubChem CID | 144641135 |
| Molecular Formula | C25H32N6O4S3 |
| Molecular Weight | 576.77 g/mol |
| Exact Mass | 576.16 |
| IUPAC Name | [N'-[2-(3-methoxyphenyl)acetyl]carbamimidoyl] 3-[2-amino-2-[N-[2-(3-methoxyphenyl)acetyl]carbamimidoyl]sulfanylethyl]sulfanylpropanimidothioate |
| SMILES | [H]/N=C(/CCSCC(N)S/C(=N\[H])NC(=O)Cc1cccc(OC)c1)S/C(N)=N/C(=O)Cc1cccc(OC)c1 |
| InChI | InChI=1S/C25H32N6O4S3/c1-34-18-7-3-5-16(11-18)13-22(32)30-24(28)37-20(26)9-10-36-15-21(27)38-25(29)31-23(33)14-17-6-4-8-19(12-17)35-2/h3-8,11-12,21,26H,9-10,13-15,27H2,1-2H3,(H2,28,30,32)(H2,29,31,33)/b26-20- |
| InChIKey | UEHDDRGHTHICAP-QOMWVZHYSA-N |
| XLogP | 3.23 |
| TPSA | 176.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.77 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|