C30H32N8O2S2 — CID 123408611
[N'-[2-(1-methylindol-3-yl)acetyl]carbamimidoyl] 5-[5-[[2-(1-methylindol-3-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]pentanimidothioate (PubChem CID 123408611) has the molecular formula C30H32N8O2S2 and a molecular weight of 600.77 g/mol. Its IUPAC name is [N'-[2-(1-methylindol-3-yl)acetyl]carbamimidoyl] 5-[5-[[2-(1-methylindol-3-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]pentanimidothioate.
| Compound Name | [N'-[2-(1-methylindol-3-yl)acetyl]carbamimidoyl] 5-[5-[[2-(1-methylindol-3-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]pentanimidothioate |
|---|---|
| PubChem CID | 123408611 |
| Molecular Formula | C30H32N8O2S2 |
| Molecular Weight | 600.77 g/mol |
| Exact Mass | 600.21 |
| IUPAC Name | [N'-[2-(1-methylindol-3-yl)acetyl]carbamimidoyl] 5-[5-[[2-(1-methylindol-3-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]pentanimidothioate |
| SMILES | [H]/N=C(/CCCCc1nnc(NC(=O)Cc2cn(C)c3ccccc23)s1)S/C(N)=N/C(=O)Cc1cn(C)c2ccccc12 |
| InChI | InChI=1S/C30H32N8O2S2/c1-37-17-19(21-9-3-5-11-23(21)37)15-26(39)33-29(32)41-25(31)13-7-8-14-28-35-36-30(42-28)34-27(40)16-20-18-38(2)24-12-6-4-10-22(20)24/h3-6,9-12,17-18,31H,7-8,13-16H2,1-2H3,(H2,32,33,39)(H,34,36,40)/b31-25- |
| InChIKey | NKFQLWJBVAPPNE-GDWJVWIDSA-N |
| XLogP | 5.21 |
| TPSA | 144.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.77 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|