C30H38N6O5S2 — CID 91808710
N-[5-[8-amino-5-imino-8-[2-[3-(3-methylsulfonylpropoxy)phenyl]acetyl]iminooctyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide (PubChem CID 91808710) has the molecular formula C30H38N6O5S2 and a molecular weight of 626.81 g/mol. Its IUPAC name is N-[5-[8-amino-5-imino-8-[2-[3-(3-methylsulfonylpropoxy)phenyl]acetyl]iminooctyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide.
| Compound Name | N-[5-[8-amino-5-imino-8-[2-[3-(3-methylsulfonylpropoxy)phenyl]acetyl]iminooctyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 91808710 |
| Molecular Formula | C30H38N6O5S2 |
| Molecular Weight | 626.81 g/mol |
| Exact Mass | 626.23 |
| IUPAC Name | N-[5-[8-amino-5-imino-8-[2-[3-(3-methylsulfonylpropoxy)phenyl]acetyl]iminooctyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide |
| SMILES | [H]/N=C(\CCCCc1nnc(NC(=O)Cc2ccccc2)s1)CC/C(N)=N\C(=O)Cc1cccc(OCCCS(C)(=O)=O)c1 |
| InChI | InChI=1S/C30H38N6O5S2/c1-43(39,40)18-8-17-41-25-13-7-11-23(19-25)21-27(37)33-26(32)16-15-24(31)12-5-6-14-29-35-36-30(42-29)34-28(38)20-22-9-3-2-4-10-22/h2-4,7,9-11,13,19,31H,5-6,8,12,14-18,20-21H2,1H3,(H2,32,33,37)(H,34,36,38)/b31-24+ |
| InChIKey | ZZAJINAWOBFPRF-QFMPWRQOSA-N |
| XLogP | 4.17 |
| TPSA | 177.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.81 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|