C18H24N6OS — CID 123261624
N-[1-amino-8-(5-amino-1,3,4-thiadiazol-2-yl)-4-iminooctylidene]-2-phenylacetamide (PubChem CID 123261624) has the molecular formula C18H24N6OS and a molecular weight of 372.50 g/mol. Its IUPAC name is N-[1-amino-8-(5-amino-1,3,4-thiadiazol-2-yl)-4-iminooctylidene]-2-phenylacetamide.
| Compound Name | N-[1-amino-8-(5-amino-1,3,4-thiadiazol-2-yl)-4-iminooctylidene]-2-phenylacetamide |
|---|---|
| PubChem CID | 123261624 |
| Molecular Formula | C18H24N6OS |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | N-[1-amino-8-(5-amino-1,3,4-thiadiazol-2-yl)-4-iminooctylidene]-2-phenylacetamide |
| SMILES | [H]/N=C(\CCCCc1nnc(N)s1)CC/C(N)=N\C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C18H24N6OS/c19-14(8-4-5-9-17-23-24-18(21)26-17)10-11-15(20)22-16(25)12-13-6-2-1-3-7-13/h1-3,6-7,19H,4-5,8-12H2,(H2,21,24)(H2,20,22,25)/b19-14+ |
| InChIKey | XCXSFLROXPYNHA-XMHGGMMESA-N |
| XLogP | 2.76 |
| TPSA | 131.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|