C28H34N6O4S2 — CID 123993773
N-[5-[8-amino-5-imino-8-[2-[3-(methylsulfonylmethyl)phenyl]acetyl]iminooctyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide (PubChem CID 123993773) has the molecular formula C28H34N6O4S2 and a molecular weight of 582.75 g/mol. Its IUPAC name is N-[5-[8-amino-5-imino-8-[2-[3-(methylsulfonylmethyl)phenyl]acetyl]iminooctyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide.
| Compound Name | N-[5-[8-amino-5-imino-8-[2-[3-(methylsulfonylmethyl)phenyl]acetyl]iminooctyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 123993773 |
| Molecular Formula | C28H34N6O4S2 |
| Molecular Weight | 582.75 g/mol |
| Exact Mass | 582.21 |
| IUPAC Name | N-[5-[8-amino-5-imino-8-[2-[3-(methylsulfonylmethyl)phenyl]acetyl]iminooctyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide |
| SMILES | [H]/N=C(\CCCCc1nnc(NC(=O)Cc2ccccc2)s1)CC/C(N)=N\C(=O)Cc1cccc(CS(C)(=O)=O)c1 |
| InChI | InChI=1S/C28H34N6O4S2/c1-40(37,38)19-22-11-7-10-21(16-22)18-25(35)31-24(30)15-14-23(29)12-5-6-13-27-33-34-28(39-27)32-26(36)17-20-8-3-2-4-9-20/h2-4,7-11,16,29H,5-6,12-15,17-19H2,1H3,(H2,30,31,35)(H,32,34,36)/b29-23+ |
| InChIKey | SWNLNJIOMOGTJP-BYNJWEBRSA-N |
| XLogP | 3.90 |
| TPSA | 168.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.75 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|