C23H24N6O4S3 — CID 118371221
[N'-[(2S)-2-hydroxy-2-phenylacetyl]carbamimidoyl] 3-[[5-[[(2S)-2-hydroxy-2-phenylacetyl]amino]-1,3,4-thiadiazol-2-yl]methylsulfanyl]propanimidothioate (PubChem CID 118371221) has the molecular formula C23H24N6O4S3 and a molecular weight of 544.68 g/mol. Its IUPAC name is [N'-[(2S)-2-hydroxy-2-phenylacetyl]carbamimidoyl] 3-[[5-[[(2S)-2-hydroxy-2-phenylacetyl]amino]-1,3,4-thiadiazol-2-yl]methylsulfanyl]propanimidothioate.
| Compound Name | [N'-[(2S)-2-hydroxy-2-phenylacetyl]carbamimidoyl] 3-[[5-[[(2S)-2-hydroxy-2-phenylacetyl]amino]-1,3,4-thiadiazol-2-yl]methylsulfanyl]propanimidothioate |
|---|---|
| PubChem CID | 118371221 |
| Molecular Formula | C23H24N6O4S3 |
| Molecular Weight | 544.68 g/mol |
| Exact Mass | 544.10 |
| IUPAC Name | [N'-[(2S)-2-hydroxy-2-phenylacetyl]carbamimidoyl] 3-[[5-[[(2S)-2-hydroxy-2-phenylacetyl]amino]-1,3,4-thiadiazol-2-yl]methylsulfanyl]propanimidothioate |
| SMILES | [H]/N=C(/CCSCc1nnc(NC(=O)[C@@H](O)c2ccccc2)s1)S/C(N)=N/C(=O)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C23H24N6O4S3/c24-16(35-22(25)26-20(32)18(30)14-7-3-1-4-8-14)11-12-34-13-17-28-29-23(36-17)27-21(33)19(31)15-9-5-2-6-10-15/h1-10,18-19,24,30-31H,11-13H2,(H2,25,26,32)(H,27,29,33)/b24-16-/t18-,19-/m0/s1 |
| InChIKey | HJCPNKFCFLVANU-QKYNOIMASA-N |
| XLogP | 3.12 |
| TPSA | 174.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.68 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|