C22H19N5 — CID 143662608
6-phenyl-2-(3-quinolin-6-ylpropanimidoyl)pyridazin-3-imine (PubChem CID 143662608) has the molecular formula C22H19N5 and a molecular weight of 353.43 g/mol. Its IUPAC name is 6-phenyl-2-(3-quinolin-6-ylpropanimidoyl)pyridazin-3-imine.
| Compound Name | 6-phenyl-2-(3-quinolin-6-ylpropanimidoyl)pyridazin-3-imine |
|---|---|
| PubChem CID | 143662608 |
| Molecular Formula | C22H19N5 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 6-phenyl-2-(3-quinolin-6-ylpropanimidoyl)pyridazin-3-imine |
| SMILES | [H]/N=C(\CCc1ccc2ncccc2c1)n1nc(-c2ccccc2)cc/c1=N\[H] |
| InChI | InChI=1S/C22H19N5/c23-21(12-9-16-8-10-19-18(15-16)7-4-14-25-19)27-22(24)13-11-20(26-27)17-5-2-1-3-6-17/h1-8,10-11,13-15,23-24H,9,12H2/b23-21+,24-22+ |
| InChIKey | MFZCCRDUHFWNQE-MBALSZOMSA-N |
| XLogP | 4.04 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|