C22H20N6O — CID 154445104
2-[3-(7-methoxy-1,5-naphthyridin-4-yl)propanimidoyl]-6-phenylpyridazin-3-imine (PubChem CID 154445104) has the molecular formula C22H20N6O and a molecular weight of 384.44 g/mol. Its IUPAC name is 2-[3-(7-methoxy-1,5-naphthyridin-4-yl)propanimidoyl]-6-phenylpyridazin-3-imine.
| Compound Name | 2-[3-(7-methoxy-1,5-naphthyridin-4-yl)propanimidoyl]-6-phenylpyridazin-3-imine |
|---|---|
| PubChem CID | 154445104 |
| Molecular Formula | C22H20N6O |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 2-[3-(7-methoxy-1,5-naphthyridin-4-yl)propanimidoyl]-6-phenylpyridazin-3-imine |
| SMILES | [H]/N=C(\CCc1ccnc2cc(OC)cnc12)n1nc(-c2ccccc2)cc/c1=N\[H] |
| InChI | InChI=1S/C22H20N6O/c1-29-17-13-19-22(26-14-17)16(11-12-25-19)7-9-20(23)28-21(24)10-8-18(27-28)15-5-3-2-4-6-15/h2-6,8,10-14,23-24H,7,9H2,1H3/b23-20+,24-21+ |
| InChIKey | UGOTYELWMHPXOW-GKXZNNNVSA-N |
| XLogP | 3.44 |
| TPSA | 100.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|