C19H18ClNO3 — CID 170330696
3-[2-(4-methoxyphenyl)quinolin-4-yl]propanoic acid;hydrochloride (PubChem CID 170330696) has the molecular formula C19H18ClNO3 and a molecular weight of 343.81 g/mol. Its IUPAC name is 3-[2-(4-methoxyphenyl)quinolin-4-yl]propanoic acid;hydrochloride.
| Compound Name | 3-[2-(4-methoxyphenyl)quinolin-4-yl]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 170330696 |
| Molecular Formula | C19H18ClNO3 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 3-[2-(4-methoxyphenyl)quinolin-4-yl]propanoic acid;hydrochloride |
| SMILES | COc1ccc(-c2cc(CCC(=O)O)c3ccccc3n2)cc1.Cl |
| InChI | InChI=1S/C19H17NO3.ClH/c1-23-15-9-6-13(7-10-15)18-12-14(8-11-19(21)22)16-4-2-3-5-17(16)20-18;/h2-7,9-10,12H,8,11H2,1H3,(H,21,22);1H |
| InChIKey | XUPMQGKSCUFAFC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |