C19H14F3NO3 — CID 170330476
3-[2-[4-(trifluoromethoxy)phenyl]quinolin-4-yl]propanoic acid (PubChem CID 170330476) has the molecular formula C19H14F3NO3 and a molecular weight of 361.32 g/mol. Its IUPAC name is 3-[2-[4-(trifluoromethoxy)phenyl]quinolin-4-yl]propanoic acid.
| Compound Name | 3-[2-[4-(trifluoromethoxy)phenyl]quinolin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 170330476 |
| Molecular Formula | C19H14F3NO3 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 3-[2-[4-(trifluoromethoxy)phenyl]quinolin-4-yl]propanoic acid |
| SMILES | O=C(O)CCc1cc(-c2ccc(OC(F)(F)F)cc2)nc2ccccc12 |
| InChI | InChI=1S/C19H14F3NO3/c20-19(21,22)26-14-8-5-12(6-9-14)17-11-13(7-10-18(24)25)15-3-1-2-4-16(15)23-17/h1-6,8-9,11H,7,10H2,(H,24,25) |
| InChIKey | KXYYMNSFQVFZNG-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |