C20H18N6 — CID 143662580
6-methyl-2-[2-[3-(1H-pyrrol-2-yl)quinolin-6-yl]ethanimidoyl]pyridazin-3-imine (PubChem CID 143662580) has the molecular formula C20H18N6 and a molecular weight of 342.41 g/mol. Its IUPAC name is 6-methyl-2-[2-[3-(1H-pyrrol-2-yl)quinolin-6-yl]ethanimidoyl]pyridazin-3-imine.
| Compound Name | 6-methyl-2-[2-[3-(1H-pyrrol-2-yl)quinolin-6-yl]ethanimidoyl]pyridazin-3-imine |
|---|---|
| PubChem CID | 143662580 |
| Molecular Formula | C20H18N6 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 6-methyl-2-[2-[3-(1H-pyrrol-2-yl)quinolin-6-yl]ethanimidoyl]pyridazin-3-imine |
| SMILES | [H]/N=C(/Cc1ccc2ncc(-c3ccc[nH]3)cc2c1)n1nc(C)cc/c1=N\[H] |
| InChI | InChI=1S/C20H18N6/c1-13-4-7-19(21)26(25-13)20(22)10-14-5-6-18-15(9-14)11-16(12-24-18)17-3-2-8-23-17/h2-9,11-12,21-23H,10H2,1H3/b21-19+,22-20- |
| InChIKey | GIKTXVQMGUSHCZ-FHGBILNFSA-N |
| XLogP | 3.28 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|