C24H25FN8 — CID 143662458
2-[2-fluoro-2-[3-(1-piperidin-4-ylpyrazol-4-yl)quinolin-6-yl]ethanimidoyl]-6-methylpyridazin-3-imine (PubChem CID 143662458) has the molecular formula C24H25FN8 and a molecular weight of 444.52 g/mol. Its IUPAC name is 2-[2-fluoro-2-[3-(1-piperidin-4-ylpyrazol-4-yl)quinolin-6-yl]ethanimidoyl]-6-methylpyridazin-3-imine.
| Compound Name | 2-[2-fluoro-2-[3-(1-piperidin-4-ylpyrazol-4-yl)quinolin-6-yl]ethanimidoyl]-6-methylpyridazin-3-imine |
|---|---|
| PubChem CID | 143662458 |
| Molecular Formula | C24H25FN8 |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 2-[2-fluoro-2-[3-(1-piperidin-4-ylpyrazol-4-yl)quinolin-6-yl]ethanimidoyl]-6-methylpyridazin-3-imine |
| SMILES | [H]/N=C(/C(F)c1ccc2ncc(-c3cnn(C4CCNCC4)c3)cc2c1)n1nc(C)cc/c1=N\[H] |
| InChI | InChI=1S/C24H25FN8/c1-15-2-5-22(26)33(31-15)24(27)23(25)16-3-4-21-17(10-16)11-18(12-29-21)19-13-30-32(14-19)20-6-8-28-9-7-20/h2-5,10-14,20,23,26-28H,6-9H2,1H3/b26-22+,27-24- |
| InChIKey | RMNPQFDTQDUSTK-VMYVUXIHSA-N |
| XLogP | 3.54 |
| TPSA | 108.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|