C20H18FN7 — CID 70665637
2-[2-[7-fluoro-3-(1-methylpyrazol-4-yl)quinolin-6-yl]ethanimidoyl]-6-methylpyridazin-3-imine (PubChem CID 70665637) has the molecular formula C20H18FN7 and a molecular weight of 375.41 g/mol. Its IUPAC name is 2-[2-[7-fluoro-3-(1-methylpyrazol-4-yl)quinolin-6-yl]ethanimidoyl]-6-methylpyridazin-3-imine.
| Compound Name | 2-[2-[7-fluoro-3-(1-methylpyrazol-4-yl)quinolin-6-yl]ethanimidoyl]-6-methylpyridazin-3-imine |
|---|---|
| PubChem CID | 70665637 |
| Molecular Formula | C20H18FN7 |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 2-[2-[7-fluoro-3-(1-methylpyrazol-4-yl)quinolin-6-yl]ethanimidoyl]-6-methylpyridazin-3-imine |
| SMILES | [H]/N=C(/Cc1cc2cc(-c3cnn(C)c3)cnc2cc1F)n1nc(C)cc/c1=N\[H] |
| InChI | InChI=1S/C20H18FN7/c1-12-3-4-19(22)28(26-12)20(23)7-13-5-14-6-15(16-10-25-27(2)11-16)9-24-18(14)8-17(13)21/h3-6,8-11,22-23H,7H2,1-2H3/b22-19+,23-20- |
| InChIKey | FSPZGXPETGMUJK-JMALZQNKSA-N |
| XLogP | 2.83 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|