C21H21FN7+ — CID 143662517
6-ethyl-2-[2-[7-fluoro-3-(1-methylpyrazol-4-yl)quinolin-6-yl]ethanimidoyl]pyridazin-2-ium-3-amine (PubChem CID 143662517) has the molecular formula C21H21FN7+ and a molecular weight of 390.45 g/mol. Its IUPAC name is 6-ethyl-2-[2-[7-fluoro-3-(1-methylpyrazol-4-yl)quinolin-6-yl]ethanimidoyl]pyridazin-2-ium-3-amine.
| Compound Name | 6-ethyl-2-[2-[7-fluoro-3-(1-methylpyrazol-4-yl)quinolin-6-yl]ethanimidoyl]pyridazin-2-ium-3-amine |
|---|---|
| PubChem CID | 143662517 |
| Molecular Formula | C21H21FN7+ |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 6-ethyl-2-[2-[7-fluoro-3-(1-methylpyrazol-4-yl)quinolin-6-yl]ethanimidoyl]pyridazin-2-ium-3-amine |
| SMILES | [H]/N=C(/Cc1cc2cc(-c3cnn(C)c3)cnc2cc1F)[n+]1nc(CC)ccc1N |
| InChI | InChI=1S/C21H20FN7/c1-3-17-4-5-20(23)29(27-17)21(24)8-13-6-14-7-15(16-11-26-28(2)12-16)10-25-19(14)9-18(13)22/h4-7,9-12,23-24H,3,8H2,1-2H3/p+1/b24-21- |
| InChIKey | YVXWPMXHNVEXFJ-FLFQWRMESA-O |
| XLogP | 2.67 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|