C17H16N7S+ — CID 143662502
2-[2-(1,3-benzothiazol-6-yl)ethanimidoyl]-6-(1-methylpyrazol-4-yl)pyridazin-2-ium-3-amine (PubChem CID 143662502) has the molecular formula C17H16N7S+ and a molecular weight of 350.43 g/mol. Its IUPAC name is 2-[2-(1,3-benzothiazol-6-yl)ethanimidoyl]-6-(1-methylpyrazol-4-yl)pyridazin-2-ium-3-amine.
| Compound Name | 2-[2-(1,3-benzothiazol-6-yl)ethanimidoyl]-6-(1-methylpyrazol-4-yl)pyridazin-2-ium-3-amine |
|---|---|
| PubChem CID | 143662502 |
| Molecular Formula | C17H16N7S+ |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 2-[2-(1,3-benzothiazol-6-yl)ethanimidoyl]-6-(1-methylpyrazol-4-yl)pyridazin-2-ium-3-amine |
| SMILES | [H]/N=C(/Cc1ccc2ncsc2c1)[n+]1nc(-c2cnn(C)c2)ccc1N |
| InChI | InChI=1S/C17H15N7S/c1-23-9-12(8-21-23)13-4-5-16(18)24(22-13)17(19)7-11-2-3-14-15(6-11)25-10-20-14/h2-6,8-10,18-19H,7H2,1H3/p+1/b19-17- |
| InChIKey | RJQGCWIBDQSDPP-ZPHPHTNESA-O |
| XLogP | 2.03 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|