C18H15FN8 — CID 143662489
2-[2-fluoro-2-[3-(1-methylpyrazol-4-yl)quinolin-6-yl]ethanimidoyl]-1,2,4-triazin-3-imine (PubChem CID 143662489) has the molecular formula C18H15FN8 and a molecular weight of 362.37 g/mol. Its IUPAC name is 2-[2-fluoro-2-[3-(1-methylpyrazol-4-yl)quinolin-6-yl]ethanimidoyl]-1,2,4-triazin-3-imine.
| Compound Name | 2-[2-fluoro-2-[3-(1-methylpyrazol-4-yl)quinolin-6-yl]ethanimidoyl]-1,2,4-triazin-3-imine |
|---|---|
| PubChem CID | 143662489 |
| Molecular Formula | C18H15FN8 |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 2-[2-fluoro-2-[3-(1-methylpyrazol-4-yl)quinolin-6-yl]ethanimidoyl]-1,2,4-triazin-3-imine |
| SMILES | [H]/N=C(/C(F)c1ccc2ncc(-c3cnn(C)c3)cc2c1)n1nccn/c1=N\[H] |
| InChI | InChI=1S/C18H15FN8/c1-26-10-14(9-25-26)13-7-12-6-11(2-3-15(12)23-8-13)16(19)17(20)27-18(21)22-4-5-24-27/h2-10,16,20-21H,1H3/b20-17-,21-18+ |
| InChIKey | NPBHSDGSNZHMDD-WPDZNWIASA-N |
| XLogP | 2.24 |
| TPSA | 109.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|