C22H20N8O — CID 140622894
(NE)-N-[1-[3-[1-[3-(1-methylpyrazol-4-yl)quinolin-6-yl]ethyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]ethylidene]hydroxylamine (PubChem CID 140622894) has the molecular formula C22H20N8O and a molecular weight of 412.46 g/mol. Its IUPAC name is (NE)-N-[1-[3-[1-[3-(1-methylpyrazol-4-yl)quinolin-6-yl]ethyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]ethylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-[3-[1-[3-(1-methylpyrazol-4-yl)quinolin-6-yl]ethyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 140622894 |
| Molecular Formula | C22H20N8O |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | (NE)-N-[1-[3-[1-[3-(1-methylpyrazol-4-yl)quinolin-6-yl]ethyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]ethylidene]hydroxylamine |
| SMILES | C/C(=N\O)c1ccc2nnc(C(C)c3ccc4ncc(-c5cnn(C)c5)cc4c3)n2n1 |
| InChI | InChI=1S/C22H20N8O/c1-13(22-26-25-21-7-6-19(14(2)28-31)27-30(21)22)15-4-5-20-16(8-15)9-17(10-23-20)18-11-24-29(3)12-18/h4-13,31H,1-3H3/b28-14+ |
| InChIKey | AIXKHGFKJKCCKY-CCVNUDIWSA-N |
| XLogP | 3.42 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|