C22H18F2N8O — CID 140622872
(NE)-N-[1-[3-[(1R)-1-[5,7-difluoro-3-(1-methylpyrazol-4-yl)quinolin-6-yl]ethyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]ethylidene]hydroxylamine (PubChem CID 140622872) has the molecular formula C22H18F2N8O and a molecular weight of 448.44 g/mol. Its IUPAC name is (NE)-N-[1-[3-[(1R)-1-[5,7-difluoro-3-(1-methylpyrazol-4-yl)quinolin-6-yl]ethyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]ethylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-[3-[(1R)-1-[5,7-difluoro-3-(1-methylpyrazol-4-yl)quinolin-6-yl]ethyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 140622872 |
| Molecular Formula | C22H18F2N8O |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | (NE)-N-[1-[3-[(1R)-1-[5,7-difluoro-3-(1-methylpyrazol-4-yl)quinolin-6-yl]ethyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]ethylidene]hydroxylamine |
| SMILES | C/C(=N\O)c1ccc2nnc([C@H](C)c3c(F)cc4ncc(-c5cnn(C)c5)cc4c3F)n2n1 |
| InChI | InChI=1S/C22H18F2N8O/c1-11(22-28-27-19-5-4-17(12(2)30-33)29-32(19)22)20-16(23)7-18-15(21(20)24)6-13(8-25-18)14-9-26-31(3)10-14/h4-11,33H,1-3H3/b30-12+/t11-/m1/s1 |
| InChIKey | OQVMGUPDTGKGSF-KOWPVSJFSA-N |
| XLogP | 3.70 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|