C23H16F2N4O2 — CID 141370379
2-[1-[5,7-difluoro-3-(1-methylpyrazol-4-yl)quinolin-6-yl]ethyl]isoindole-1,3-dione (PubChem CID 141370379) has the molecular formula C23H16F2N4O2 and a molecular weight of 418.40 g/mol. Its IUPAC name is 2-[1-[5,7-difluoro-3-(1-methylpyrazol-4-yl)quinolin-6-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[1-[5,7-difluoro-3-(1-methylpyrazol-4-yl)quinolin-6-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 141370379 |
| Molecular Formula | C23H16F2N4O2 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 2-[1-[5,7-difluoro-3-(1-methylpyrazol-4-yl)quinolin-6-yl]ethyl]isoindole-1,3-dione |
| SMILES | CC(c1c(F)cc2ncc(-c3cnn(C)c3)cc2c1F)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H16F2N4O2/c1-12(29-22(30)15-5-3-4-6-16(15)23(29)31)20-18(24)8-19-17(21(20)25)7-13(9-26-19)14-10-27-28(2)11-14/h3-12H,1-2H3 |
| InChIKey | ACNMLPXOTFHOEV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|