C24H16FN3O2 — CID 58318641
2-[1-[2-(3-fluorophenyl)-1,5-naphthyridin-3-yl]ethyl]isoindole-1,3-dione (PubChem CID 58318641) has the molecular formula C24H16FN3O2 and a molecular weight of 397.41 g/mol. Its IUPAC name is 2-[1-[2-(3-fluorophenyl)-1,5-naphthyridin-3-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[1-[2-(3-fluorophenyl)-1,5-naphthyridin-3-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58318641 |
| Molecular Formula | C24H16FN3O2 |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 2-[1-[2-(3-fluorophenyl)-1,5-naphthyridin-3-yl]ethyl]isoindole-1,3-dione |
| SMILES | CC(c1cc2ncccc2nc1-c1cccc(F)c1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H16FN3O2/c1-14(28-23(29)17-8-2-3-9-18(17)24(28)30)19-13-21-20(10-5-11-26-21)27-22(19)15-6-4-7-16(25)12-15/h2-14H,1H3 |
| InChIKey | JESKZZQLUDYCDH-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|