About 3-(3,4-dimethylphenyl)-2-(3-fluorophenyl)pyridine
3-(3,4-dimethylphenyl)-2-(3-fluorophenyl)pyridine (PubChem CID 144943522) has the molecular formula C19H16FN
and a molecular weight of 277.34 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-2-(3-fluorophenyl)pyridine.
Molecular Properties
| Compound Name | 3-(3,4-dimethylphenyl)-2-(3-fluorophenyl)pyridine |
| PubChem CID | 144943522 |
| Molecular Formula | C19H16FN |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-2-(3-fluorophenyl)pyridine |
| SMILES | Cc1ccc(-c2cccnc2-c2cccc(F)c2)cc1C |
| InChI | InChI=1S/C19H16FN/c1-13-8-9-15(11-14(13)2)18-7-4-10-21-19(18)16-5-3-6-17(20)12-16/h3-12H,1-2H3 |
| InChIKey | MRVLALFJRGPVPD-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(3,4-dimethylphenyl)-2-(3-fluorophenyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dimethylphenyl)-2-(3-fluorophenyl)pyridine?
The IUPAC name of 3-(3,4-dimethylphenyl)-2-(3-fluorophenyl)pyridine (CID 144943522) is 3-(3,4-dimethylphenyl)-2-(3-fluorophenyl)pyridine.
What is the SMILES notation for 3-(3,4-dimethylphenyl)-2-(3-fluorophenyl)pyridine?
The canonical SMILES for 3-(3,4-dimethylphenyl)-2-(3-fluorophenyl)pyridine is Cc1ccc(-c2cccnc2-c2cccc(F)c2)cc1C.
What is the InChIKey of 3-(3,4-dimethylphenyl)-2-(3-fluorophenyl)pyridine?
The InChIKey is MRVLALFJRGPVPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16FN/c1-13-8-9-15(11-14(13)2)18-7-4-10-21-19(18)16-5-3-6-17(20)12-16/h3-12H,1-2H3.
What are the key properties of 3-(3,4-dimethylphenyl)-2-(3-fluorophenyl)pyridine?
3-(3,4-dimethylphenyl)-2-(3-fluorophenyl)pyridine has a molecular weight of 277.34 g/mol, XLogP of 5.17, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dimethylphenyl)-2-(3-fluorophenyl)pyridine is sourced from PubChem (CID 144943522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).