C14H12N2 — CID 117001809
2-(3,4-dimethylphenyl)pyridine-3-carbonitrile (PubChem CID 117001809) has the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)pyridine-3-carbonitrile.
| Compound Name | 2-(3,4-dimethylphenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 117001809 |
| Molecular Formula | C14H12N2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 2-(3,4-dimethylphenyl)pyridine-3-carbonitrile |
| SMILES | Cc1ccc(-c2ncccc2C#N)cc1C |
| InChI | InChI=1S/C14H12N2/c1-10-5-6-12(8-11(10)2)14-13(9-15)4-3-7-16-14/h3-8H,1-2H3 |
| InChIKey | PPSAJGNPZGHJMB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |