C14H13F — CID 54184747
1-(3-fluorophenyl)-2,3-dimethylbenzene (PubChem CID 54184747) has the molecular formula C14H13F and a molecular weight of 200.26 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-2,3-dimethylbenzene.
| Compound Name | 1-(3-fluorophenyl)-2,3-dimethylbenzene |
|---|---|
| PubChem CID | 54184747 |
| Molecular Formula | C14H13F |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 1-(3-fluorophenyl)-2,3-dimethylbenzene |
| SMILES | Cc1cccc(-c2cccc(F)c2)c1C |
| InChI | InChI=1S/C14H13F/c1-10-5-3-8-14(11(10)2)12-6-4-7-13(15)9-12/h3-9H,1-2H3 |
| InChIKey | CYVCRDLNTUCMIG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |