C25H19N3O4S — CID 58318636
2-[1-[2-(2-methylsulfonylphenyl)-1,5-naphthyridin-3-yl]ethyl]isoindole-1,3-dione (PubChem CID 58318636) has the molecular formula C25H19N3O4S and a molecular weight of 457.51 g/mol. Its IUPAC name is 2-[1-[2-(2-methylsulfonylphenyl)-1,5-naphthyridin-3-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[1-[2-(2-methylsulfonylphenyl)-1,5-naphthyridin-3-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58318636 |
| Molecular Formula | C25H19N3O4S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | 2-[1-[2-(2-methylsulfonylphenyl)-1,5-naphthyridin-3-yl]ethyl]isoindole-1,3-dione |
| SMILES | CC(c1cc2ncccc2nc1-c1ccccc1S(C)(=O)=O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H19N3O4S/c1-15(28-24(29)16-8-3-4-9-17(16)25(28)30)19-14-21-20(11-7-13-26-21)27-23(19)18-10-5-6-12-22(18)33(2,31)32/h3-15H,1-2H3 |
| InChIKey | NAJAZADOHTWYMJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 97.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|