C28H27ClN6O — CID 71767481
2-chloro-N-[3-(dimethylamino)propyl]-4-[3-(quinolin-6-ylmethyl)imidazo[4,5-b]pyridin-5-yl]benzamide (PubChem CID 71767481) has the molecular formula C28H27ClN6O and a molecular weight of 499.02 g/mol. Its IUPAC name is 2-chloro-N-[3-(dimethylamino)propyl]-4-[3-(quinolin-6-ylmethyl)imidazo[4,5-b]pyridin-5-yl]benzamide.
| Compound Name | 2-chloro-N-[3-(dimethylamino)propyl]-4-[3-(quinolin-6-ylmethyl)imidazo[4,5-b]pyridin-5-yl]benzamide |
|---|---|
| PubChem CID | 71767481 |
| Molecular Formula | C28H27ClN6O |
| Molecular Weight | 499.02 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 2-chloro-N-[3-(dimethylamino)propyl]-4-[3-(quinolin-6-ylmethyl)imidazo[4,5-b]pyridin-5-yl]benzamide |
| SMILES | CN(C)CCCNC(=O)c1ccc(-c2ccc3ncn(Cc4ccc5ncccc5c4)c3n2)cc1Cl |
| InChI | InChI=1S/C28H27ClN6O/c1-34(2)14-4-13-31-28(36)22-8-7-21(16-23(22)29)25-10-11-26-27(33-25)35(18-32-26)17-19-6-9-24-20(15-19)5-3-12-30-24/h3,5-12,15-16,18H,4,13-14,17H2,1-2H3,(H,31,36) |
| InChIKey | PTQCRESIPQOMLP-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.02 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|