C28H27ClN6O — CID 58514614
1-[2-chloro-4-[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyridin-5-yl]phenyl]-5-(dimethylamino)pentan-1-one (PubChem CID 58514614) has the molecular formula C28H27ClN6O and a molecular weight of 499.02 g/mol. Its IUPAC name is 1-[2-chloro-4-[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyridin-5-yl]phenyl]-5-(dimethylamino)pentan-1-one.
| Compound Name | 1-[2-chloro-4-[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyridin-5-yl]phenyl]-5-(dimethylamino)pentan-1-one |
|---|---|
| PubChem CID | 58514614 |
| Molecular Formula | C28H27ClN6O |
| Molecular Weight | 499.02 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 1-[2-chloro-4-[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyridin-5-yl]phenyl]-5-(dimethylamino)pentan-1-one |
| SMILES | CN(C)CCCCC(=O)c1ccc(-c2ccc3nnn(Cc4ccc5ncccc5c4)c3n2)cc1Cl |
| InChI | InChI=1S/C28H27ClN6O/c1-34(2)15-4-3-7-27(36)22-10-9-21(17-23(22)29)25-12-13-26-28(31-25)35(33-32-26)18-19-8-11-24-20(16-19)6-5-14-30-24/h5-6,8-14,16-17H,3-4,7,15,18H2,1-2H3 |
| InChIKey | SJKPUJFLWVRWGA-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 76.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.02 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|