C20H13ClN6 — CID 58514686
6-[[5-(2-chloro-4-pyridinyl)triazolo[4,5-b]pyridin-3-yl]methyl]quinoline (PubChem CID 58514686) has the molecular formula C20H13ClN6 and a molecular weight of 372.82 g/mol. Its IUPAC name is 6-[[5-(2-chloro-4-pyridinyl)triazolo[4,5-b]pyridin-3-yl]methyl]quinoline.
| Compound Name | 6-[[5-(2-chloro-4-pyridinyl)triazolo[4,5-b]pyridin-3-yl]methyl]quinoline |
|---|---|
| PubChem CID | 58514686 |
| Molecular Formula | C20H13ClN6 |
| Molecular Weight | 372.82 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 6-[[5-(2-chloro-4-pyridinyl)triazolo[4,5-b]pyridin-3-yl]methyl]quinoline |
| SMILES | Clc1cc(-c2ccc3nnn(Cc4ccc5ncccc5c4)c3n2)ccn1 |
| InChI | InChI=1S/C20H13ClN6/c21-19-11-15(7-9-23-19)17-5-6-18-20(24-17)27(26-25-18)12-13-3-4-16-14(10-13)2-1-8-22-16/h1-11H,12H2 |
| InChIKey | QZKXDQKEKSAKKF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.82 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|