C19H13N5S — CID 54760085
6-[(5-thiophen-2-yltriazolo[4,5-b]pyridin-3-yl)methyl]quinoline (PubChem CID 54760085) has the molecular formula C19H13N5S and a molecular weight of 343.42 g/mol. Its IUPAC name is 6-[(5-thiophen-2-yltriazolo[4,5-b]pyridin-3-yl)methyl]quinoline.
| Compound Name | 6-[(5-thiophen-2-yltriazolo[4,5-b]pyridin-3-yl)methyl]quinoline |
|---|---|
| PubChem CID | 54760085 |
| Molecular Formula | C19H13N5S |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 6-[(5-thiophen-2-yltriazolo[4,5-b]pyridin-3-yl)methyl]quinoline |
| SMILES | c1csc(-c2ccc3nnn(Cc4ccc5ncccc5c4)c3n2)c1 |
| InChI | InChI=1S/C19H13N5S/c1-3-14-11-13(5-6-15(14)20-9-1)12-24-19-17(22-23-24)8-7-16(21-19)18-4-2-10-25-18/h1-11H,12H2 |
| InChIKey | VCZUDJUAXCDIRL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |