C28H27ClN6O2 — CID 140667566
2-[[2-chloro-4-[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyridin-5-yl]phenyl]methylamino]ethyl 2-methylpropanoate (PubChem CID 140667566) has the molecular formula C28H27ClN6O2 and a molecular weight of 515.02 g/mol. Its IUPAC name is 2-[[2-chloro-4-[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyridin-5-yl]phenyl]methylamino]ethyl 2-methylpropanoate.
| Compound Name | 2-[[2-chloro-4-[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyridin-5-yl]phenyl]methylamino]ethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 140667566 |
| Molecular Formula | C28H27ClN6O2 |
| Molecular Weight | 515.02 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | 2-[[2-chloro-4-[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyridin-5-yl]phenyl]methylamino]ethyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCCNCc1ccc(-c2ccc3nnn(Cc4ccc5ncccc5c4)c3n2)cc1Cl |
| InChI | InChI=1S/C28H27ClN6O2/c1-18(2)28(36)37-13-12-30-16-22-7-6-21(15-23(22)29)25-9-10-26-27(32-25)35(34-33-26)17-19-5-8-24-20(14-19)4-3-11-31-24/h3-11,14-15,18,30H,12-13,16-17H2,1-2H3 |
| InChIKey | QTNCJSJEVJJOPS-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.02 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|