C29H28N6O4 — CID 71767484
2-[[2-methyl-4-[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyridin-5-yl]benzoyl]amino]oxyethyl 2-methylpropanoate (PubChem CID 71767484) has the molecular formula C29H28N6O4 and a molecular weight of 524.58 g/mol. Its IUPAC name is 2-[[2-methyl-4-[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyridin-5-yl]benzoyl]amino]oxyethyl 2-methylpropanoate.
| Compound Name | 2-[[2-methyl-4-[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyridin-5-yl]benzoyl]amino]oxyethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 71767484 |
| Molecular Formula | C29H28N6O4 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | 2-[[2-methyl-4-[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyridin-5-yl]benzoyl]amino]oxyethyl 2-methylpropanoate |
| SMILES | Cc1cc(-c2ccc3nnn(Cc4ccc5ncccc5c4)c3n2)ccc1C(=O)NOCCOC(=O)C(C)C |
| InChI | InChI=1S/C29H28N6O4/c1-18(2)29(37)38-13-14-39-33-28(36)23-8-7-22(15-19(23)3)25-10-11-26-27(31-25)35(34-32-26)17-20-6-9-24-21(16-20)5-4-12-30-24/h4-12,15-16,18H,13-14,17H2,1-3H3,(H,33,36) |
| InChIKey | TWUZEOFUFQXMPO-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 121.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|