C24H18F2N6O3 — CID 71766032
2-fluoro-4-[3-[(7-fluoroquinolin-6-yl)methyl]triazolo[4,5-b]pyridin-5-yl]-N-(2-hydroxyethoxy)benzamide (PubChem CID 71766032) has the molecular formula C24H18F2N6O3 and a molecular weight of 476.44 g/mol. Its IUPAC name is 2-fluoro-4-[3-[(7-fluoroquinolin-6-yl)methyl]triazolo[4,5-b]pyridin-5-yl]-N-(2-hydroxyethoxy)benzamide.
| Compound Name | 2-fluoro-4-[3-[(7-fluoroquinolin-6-yl)methyl]triazolo[4,5-b]pyridin-5-yl]-N-(2-hydroxyethoxy)benzamide |
|---|---|
| PubChem CID | 71766032 |
| Molecular Formula | C24H18F2N6O3 |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 2-fluoro-4-[3-[(7-fluoroquinolin-6-yl)methyl]triazolo[4,5-b]pyridin-5-yl]-N-(2-hydroxyethoxy)benzamide |
| SMILES | O=C(NOCCO)c1ccc(-c2ccc3nnn(Cc4cc5cccnc5cc4F)c3n2)cc1F |
| InChI | InChI=1S/C24H18F2N6O3/c25-18-12-22-14(2-1-7-27-22)10-16(18)13-32-23-21(29-31-32)6-5-20(28-23)15-3-4-17(19(26)11-15)24(34)30-35-9-8-33/h1-7,10-12,33H,8-9,13H2,(H,30,34) |
| InChIKey | QFAMPEGUHUPIPJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|