C17H14ClFN6O — CID 136623818
(NE)-N-[1-[3-[(7-fluoroquinolin-6-yl)methyl]triazolo[4,5-b]pyridin-5-yl]ethylidene]hydroxylamine;hydrochloride (PubChem CID 136623818) has the molecular formula C17H14ClFN6O and a molecular weight of 372.79 g/mol. Its IUPAC name is (NE)-N-[1-[3-[(7-fluoroquinolin-6-yl)methyl]triazolo[4,5-b]pyridin-5-yl]ethylidene]hydroxylamine;hydrochloride.
| Compound Name | (NE)-N-[1-[3-[(7-fluoroquinolin-6-yl)methyl]triazolo[4,5-b]pyridin-5-yl]ethylidene]hydroxylamine;hydrochloride |
|---|---|
| PubChem CID | 136623818 |
| Molecular Formula | C17H14ClFN6O |
| Molecular Weight | 372.79 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | (NE)-N-[1-[3-[(7-fluoroquinolin-6-yl)methyl]triazolo[4,5-b]pyridin-5-yl]ethylidene]hydroxylamine;hydrochloride |
| SMILES | C/C(=N\O)c1ccc2nnn(Cc3cc4cccnc4cc3F)c2n1.Cl |
| InChI | InChI=1S/C17H13FN6O.ClH/c1-10(22-25)14-4-5-15-17(20-14)24(23-21-15)9-12-7-11-3-2-6-19-16(11)8-13(12)18;/h2-8,25H,9H2,1H3;1H/b22-10+; |
| InChIKey | VRIWGOIUDMSOLM-UAONINCZSA-N |
| XLogP | 3.18 |
| TPSA | 89.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.79 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|