C22H16FN9O — CID 71699929
N-[(E)-1-[3-[(7-fluoroquinolin-6-yl)methyl]triazolo[4,5-b]pyrazin-5-yl]ethylideneamino]pyridine-3-carboxamide (PubChem CID 71699929) has the molecular formula C22H16FN9O and a molecular weight of 441.43 g/mol. Its IUPAC name is N-[(E)-1-[3-[(7-fluoroquinolin-6-yl)methyl]triazolo[4,5-b]pyrazin-5-yl]ethylideneamino]pyridine-3-carboxamide.
| Compound Name | N-[(E)-1-[3-[(7-fluoroquinolin-6-yl)methyl]triazolo[4,5-b]pyrazin-5-yl]ethylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 71699929 |
| Molecular Formula | C22H16FN9O |
| Molecular Weight | 441.43 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | N-[(E)-1-[3-[(7-fluoroquinolin-6-yl)methyl]triazolo[4,5-b]pyrazin-5-yl]ethylideneamino]pyridine-3-carboxamide |
| SMILES | C/C(=N\NC(=O)c1cccnc1)c1cnc2nnn(Cc3cc4cccnc4cc3F)c2n1 |
| InChI | InChI=1S/C22H16FN9O/c1-13(28-30-22(33)15-5-2-6-24-10-15)19-11-26-20-21(27-19)32(31-29-20)12-16-8-14-4-3-7-25-18(14)9-17(16)23/h2-11H,12H2,1H3,(H,30,33)/b28-13+ |
| InChIKey | PPTIQILOZJVIHT-XODNFHPESA-N |
| XLogP | 2.51 |
| TPSA | 123.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|