C16H14N8 — CID 78153634
1-[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyrazin-5-yl]ethylidenehydrazine (PubChem CID 78153634) has the molecular formula C16H14N8 and a molecular weight of 318.34 g/mol. Its IUPAC name is 1-[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyrazin-5-yl]ethylidenehydrazine.
| Compound Name | 1-[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyrazin-5-yl]ethylidenehydrazine |
|---|---|
| PubChem CID | 78153634 |
| Molecular Formula | C16H14N8 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 1-[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyrazin-5-yl]ethylidenehydrazine |
| SMILES | CC(=NN)c1cnc2nnn(Cc3ccc4ncccc4c3)c2n1 |
| InChI | InChI=1S/C16H14N8/c1-10(21-17)14-8-19-15-16(20-14)24(23-22-15)9-11-4-5-13-12(7-11)3-2-6-18-13/h2-8H,9,17H2,1H3 |
| InChIKey | FHGAJELRJIIFQY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 107.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|