C19H17N7O3 — CID 76720043
methyl 2-[1-[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyrazin-5-yl]ethylideneamino]oxyacetate (PubChem CID 76720043) has the molecular formula C19H17N7O3 and a molecular weight of 391.39 g/mol. Its IUPAC name is methyl 2-[1-[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyrazin-5-yl]ethylideneamino]oxyacetate.
| Compound Name | methyl 2-[1-[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyrazin-5-yl]ethylideneamino]oxyacetate |
|---|---|
| PubChem CID | 76720043 |
| Molecular Formula | C19H17N7O3 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | methyl 2-[1-[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyrazin-5-yl]ethylideneamino]oxyacetate |
| SMILES | COC(=O)CON=C(C)c1cnc2nnn(Cc3ccc4ncccc4c3)c2n1 |
| InChI | InChI=1S/C19H17N7O3/c1-12(24-29-11-17(27)28-2)16-9-21-18-19(22-16)26(25-23-18)10-13-5-6-15-14(8-13)4-3-7-20-15/h3-9H,10-11H2,1-2H3 |
| InChIKey | GBRXAFGSUCLZIM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 117.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|