C24H22N7O4P — CID 175621530
methyl 2-[methyl-[4-[[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyrazin-5-yl]amino]phenyl]phosphoryl]oxyacetate (PubChem CID 175621530) has the molecular formula C24H22N7O4P and a molecular weight of 503.46 g/mol. Its IUPAC name is methyl 2-[methyl-[4-[[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyrazin-5-yl]amino]phenyl]phosphoryl]oxyacetate.
| Compound Name | methyl 2-[methyl-[4-[[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyrazin-5-yl]amino]phenyl]phosphoryl]oxyacetate |
|---|---|
| PubChem CID | 175621530 |
| Molecular Formula | C24H22N7O4P |
| Molecular Weight | 503.46 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | methyl 2-[methyl-[4-[[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyrazin-5-yl]amino]phenyl]phosphoryl]oxyacetate |
| SMILES | COC(=O)COP(C)(=O)c1ccc(Nc2cnc3nnn(Cc4ccc5ncccc5c4)c3n2)cc1 |
| InChI | InChI=1S/C24H22N7O4P/c1-34-22(32)15-35-36(2,33)19-8-6-18(7-9-19)27-21-13-26-23-24(28-21)31(30-29-23)14-16-5-10-20-17(12-16)4-3-11-25-20/h3-13H,14-15H2,1-2H3,(H,27,28) |
| InChIKey | QNPHQYMLVRMSCF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 134.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|