C22H19N6OP — CID 163677939
7-[[5-(3-dimethylphosphorylphenyl)triazolo[4,5-b]pyrazin-3-yl]methyl]quinoline (PubChem CID 163677939) has the molecular formula C22H19N6OP and a molecular weight of 414.41 g/mol. Its IUPAC name is 7-[[5-(3-dimethylphosphorylphenyl)triazolo[4,5-b]pyrazin-3-yl]methyl]quinoline.
| Compound Name | 7-[[5-(3-dimethylphosphorylphenyl)triazolo[4,5-b]pyrazin-3-yl]methyl]quinoline |
|---|---|
| PubChem CID | 163677939 |
| Molecular Formula | C22H19N6OP |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 7-[[5-(3-dimethylphosphorylphenyl)triazolo[4,5-b]pyrazin-3-yl]methyl]quinoline |
| SMILES | CP(C)(=O)c1cccc(-c2cnc3nnn(Cc4ccc5cccnc5c4)c3n2)c1 |
| InChI | InChI=1S/C22H19N6OP/c1-30(2,29)18-7-3-5-17(12-18)20-13-24-21-22(25-20)28(27-26-21)14-15-8-9-16-6-4-10-23-19(16)11-15/h3-13H,14H2,1-2H3 |
| InChIKey | QIAZYYMCSOERQR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 86.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|