C16H14N6O — CID 59341838
1-[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyrazin-5-yl]ethanol (PubChem CID 59341838) has the molecular formula C16H14N6O and a molecular weight of 306.33 g/mol. Its IUPAC name is 1-[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyrazin-5-yl]ethanol.
| Compound Name | 1-[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyrazin-5-yl]ethanol |
|---|---|
| PubChem CID | 59341838 |
| Molecular Formula | C16H14N6O |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1-[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyrazin-5-yl]ethanol |
| SMILES | CC(O)c1cnc2nnn(Cc3ccc4ncccc4c3)c2n1 |
| InChI | InChI=1S/C16H14N6O/c1-10(23)14-8-18-15-16(19-14)22(21-20-15)9-11-4-5-13-12(7-11)3-2-6-17-13/h2-8,10,23H,9H2,1H3 |
| InChIKey | MGSIPKLHXXHHJV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |