C26H18N6 — CID 86566655
3-phenyl-6-[(5-phenyltriazolo[4,5-b]pyrazin-3-yl)methyl]quinoline (PubChem CID 86566655) has the molecular formula C26H18N6 and a molecular weight of 414.47 g/mol. Its IUPAC name is 3-phenyl-6-[(5-phenyltriazolo[4,5-b]pyrazin-3-yl)methyl]quinoline.
| Compound Name | 3-phenyl-6-[(5-phenyltriazolo[4,5-b]pyrazin-3-yl)methyl]quinoline |
|---|---|
| PubChem CID | 86566655 |
| Molecular Formula | C26H18N6 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 3-phenyl-6-[(5-phenyltriazolo[4,5-b]pyrazin-3-yl)methyl]quinoline |
| SMILES | c1ccc(-c2cnc3ccc(Cn4nnc5ncc(-c6ccccc6)nc54)cc3c2)cc1 |
| InChI | InChI=1S/C26H18N6/c1-3-7-19(8-4-1)22-14-21-13-18(11-12-23(21)27-15-22)17-32-26-25(30-31-32)28-16-24(29-26)20-9-5-2-6-10-20/h1-16H,17H2 |
| InChIKey | DGHKLJMJEUSMSA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |