C24H25FN9OP — CID 175621557
N-[4-[bis(ethylamino)phosphoryl]-2-fluorophenyl]-3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyrazin-5-amine (PubChem CID 175621557) has the molecular formula C24H25FN9OP and a molecular weight of 505.50 g/mol. Its IUPAC name is N-[4-[bis(ethylamino)phosphoryl]-2-fluorophenyl]-3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyrazin-5-amine.
| Compound Name | N-[4-[bis(ethylamino)phosphoryl]-2-fluorophenyl]-3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyrazin-5-amine |
|---|---|
| PubChem CID | 175621557 |
| Molecular Formula | C24H25FN9OP |
| Molecular Weight | 505.50 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | N-[4-[bis(ethylamino)phosphoryl]-2-fluorophenyl]-3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyrazin-5-amine |
| SMILES | CCNP(=O)(NCC)c1ccc(Nc2cnc3nnn(Cc4ccc5ncccc5c4)c3n2)c(F)c1 |
| InChI | InChI=1S/C24H25FN9OP/c1-3-28-36(35,29-4-2)18-8-10-21(19(25)13-18)30-22-14-27-23-24(31-22)34(33-32-23)15-16-7-9-20-17(12-16)6-5-11-26-20/h5-14H,3-4,15H2,1-2H3,(H,30,31)(H2,28,29,35) |
| InChIKey | CAUQWQIRBCINTO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 122.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|