C25H23FN6O3 — CID 123184936
4-[5-diazenyl-6-[(7-fluoroquinolin-6-yl)methylamino]-2-pyridinyl]-N-(2-hydroxyethoxy)-2-methylbenzamide (PubChem CID 123184936) has the molecular formula C25H23FN6O3 and a molecular weight of 474.50 g/mol. Its IUPAC name is 4-[5-diazenyl-6-[(7-fluoroquinolin-6-yl)methylamino]-2-pyridinyl]-N-(2-hydroxyethoxy)-2-methylbenzamide.
| Compound Name | 4-[5-diazenyl-6-[(7-fluoroquinolin-6-yl)methylamino]-2-pyridinyl]-N-(2-hydroxyethoxy)-2-methylbenzamide |
|---|---|
| PubChem CID | 123184936 |
| Molecular Formula | C25H23FN6O3 |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 4-[5-diazenyl-6-[(7-fluoroquinolin-6-yl)methylamino]-2-pyridinyl]-N-(2-hydroxyethoxy)-2-methylbenzamide |
| SMILES | [H]/N=N/c1ccc(-c2ccc(C(=O)NOCCO)c(C)c2)nc1NCc1cc2cccnc2cc1F |
| InChI | InChI=1S/C25H23FN6O3/c1-15-11-17(4-5-19(15)25(34)32-35-10-9-33)21-6-7-22(31-27)24(30-21)29-14-18-12-16-3-2-8-28-23(16)13-20(18)26/h2-8,11-13,27,33H,9-10,14H2,1H3,(H,29,30)(H,32,34)/b31-27+ |
| InChIKey | UKCMGTJBGWNMIH-TVKQRKNISA-N |
| XLogP | 4.67 |
| TPSA | 132.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|