C27H26N6O2 — CID 140667578
2-[[2-methyl-4-[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyridin-5-yl]phenyl]methylamino]ethyl acetate (PubChem CID 140667578) has the molecular formula C27H26N6O2 and a molecular weight of 466.55 g/mol. Its IUPAC name is 2-[[2-methyl-4-[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyridin-5-yl]phenyl]methylamino]ethyl acetate.
| Compound Name | 2-[[2-methyl-4-[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyridin-5-yl]phenyl]methylamino]ethyl acetate |
|---|---|
| PubChem CID | 140667578 |
| Molecular Formula | C27H26N6O2 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 2-[[2-methyl-4-[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyridin-5-yl]phenyl]methylamino]ethyl acetate |
| SMILES | CC(=O)OCCNCc1ccc(-c2ccc3nnn(Cc4ccc5ncccc5c4)c3n2)cc1C |
| InChI | InChI=1S/C27H26N6O2/c1-18-14-22(6-7-23(18)16-28-12-13-35-19(2)34)25-9-10-26-27(30-25)33(32-31-26)17-20-5-8-24-21(15-20)4-3-11-29-24/h3-11,14-15,28H,12-13,16-17H2,1-2H3 |
| InChIKey | KUWOYAHXKPUNPD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|