C22H14F2N6O — CID 162489857
N-[2,6-difluoro-4-[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyridin-5-yl]phenyl]formamide (PubChem CID 162489857) has the molecular formula C22H14F2N6O and a molecular weight of 416.39 g/mol. Its IUPAC name is N-[2,6-difluoro-4-[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyridin-5-yl]phenyl]formamide.
| Compound Name | N-[2,6-difluoro-4-[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyridin-5-yl]phenyl]formamide |
|---|---|
| PubChem CID | 162489857 |
| Molecular Formula | C22H14F2N6O |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | N-[2,6-difluoro-4-[3-(quinolin-6-ylmethyl)triazolo[4,5-b]pyridin-5-yl]phenyl]formamide |
| SMILES | O=CNc1c(F)cc(-c2ccc3nnn(Cc4ccc5ncccc5c4)c3n2)cc1F |
| InChI | InChI=1S/C22H14F2N6O/c23-16-9-15(10-17(24)21(16)26-12-31)19-5-6-20-22(27-19)30(29-28-20)11-13-3-4-18-14(8-13)2-1-7-25-18/h1-10,12H,11H2,(H,26,31) |
| InChIKey | PWBMEKJTKAJZHD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|